CAS 7475-56-1
:α-Chloro-α-phenylbenzeneacetic acid
Description:
α-Chloro-α-phenylbenzeneacetic acid, with the CAS number 7475-56-1, is an organic compound characterized by its unique structure, which includes a chloro group and a phenyl group attached to a benzeneacetic acid backbone. This compound typically appears as a solid at room temperature and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the chloro substituent can influence its reactivity, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the phenyl group contributes to the compound's hydrophobic characteristics, which can affect its solubility in different solvents. The compound's acidity is attributed to the carboxylic acid functional group, allowing it to participate in acid-base reactions. Safety considerations should be taken into account when handling this substance, as it may pose health risks if ingested or inhaled. Overall, α-Chloro-α-phenylbenzeneacetic acid is a valuable compound in the field of synthetic organic chemistry.
Formula:C14H11ClO2
InChI:InChI=1S/C14H11ClO2/c15-14(13(16)17,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H,16,17)
InChI key:InChIKey=UJRMHFPTLFNSTA-UHFFFAOYSA-N
SMILES:C(C(O)=O)(Cl)(C1=CC=CC=C1)C2=CC=CC=C2
Synonyms:- α-Chloro-α-phenylbenzeneacetic acid
- 2-Chloro-2,2-diphenylacetic acid
- Chlorodiphenylacetic acid
- Benzeneacetic acid, α-chloro-α-phenyl-
- Acetic acid, chlorodiphenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.