
CAS 74764-66-2
:α-Oxo-4-pyridineacetonitrile
Description:
α-Oxo-4-pyridineacetonitrile, with the CAS number 74764-66-2, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a ketone functional group (the α-oxo part) adjacent to a nitrile group (the acetonitrile part), contributing to its reactivity and potential applications in organic synthesis. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of both the carbonyl and nitrile functional groups suggests that it could participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Additionally, compounds like α-oxo-4-pyridineacetonitrile may serve as intermediates in the synthesis of pharmaceuticals or agrochemicals, owing to the biological activity often associated with pyridine derivatives. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C7H4N2O
InChI:InChI=1S/C7H4N2O/c8-5-7(10)6-1-3-9-4-2-6/h1-4H
InChI key:InChIKey=GZKKBMGXUJZHSS-UHFFFAOYSA-N
SMILES:C(C#N)(=O)C=1C=CN=CC1
Synonyms:- α-Oxo-4-pyridineacetonitrile
- 4-Pyridineacetonitrile, α-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.