CymitQuimica logo

CAS 7477-03-4

:

1-(2-methoxyphenyl)butan-1-ol

Description:
1-(2-Methoxyphenyl)butan-1-ol, with the CAS number 7477-03-4, is an organic compound characterized by its structure, which includes a butanol moiety attached to a 2-methoxyphenyl group. This compound typically appears as a colorless to pale yellow liquid and is known for its aromatic properties due to the presence of the methoxy-substituted phenyl group. It is soluble in organic solvents and exhibits moderate polarity. The presence of the hydroxyl (-OH) group contributes to its potential as a hydrogen bond donor, influencing its reactivity and interactions with other molecules. This compound may be utilized in various applications, including as an intermediate in organic synthesis or in the formulation of fragrances and flavorings due to its pleasant aromatic profile. Additionally, its chemical properties may allow for further derivatization, making it a versatile building block in medicinal chemistry and materials science. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H16O2
InChI:InChI=1/C11H16O2/c1-3-6-10(12)9-7-4-5-8-11(9)13-2/h4-5,7-8,10,12H,3,6H2,1-2H3
SMILES:CCCC(c1ccccc1OC)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.