CAS 7477-10-3

6-chloro-5-nitropyridine-3-carboxylic acid

Description:

6-Chloro-5-nitropyridine-3-carboxylic acid is a heterocyclic organic compound characterized by a pyridine ring substituted with a chlorine atom, a nitro group, and a carboxylic acid functional group. The presence of the chlorine atom at the 6-position and the nitro group at the 5-position contributes to its reactivity and potential applications in various chemical syntheses. The carboxylic acid group at the 3-position enhances its solubility in polar solvents and allows for further functionalization. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its unique structure makes it of interest in pharmaceutical and agrochemical research, particularly in the development of biologically active molecules. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Safety precautions should be taken when handling this compound, as it may pose health risks due to its chemical nature.

Formula: C₆H₃ClN₂O₄

InChI: InChI=1/C6H3ClN2O4/c7-5-4(9(12)13)1-3(2-8-5)6(10)11/h1-2H,(H,10,11)

SMILES: c1c(cnc(c1N(=O)=O)Cl)C(=O)O

Synonyms:

• 3-Pyridinecarboxylic acid, 6-chloro-5-nitro-
• 6-Chloro-5-nitronicotinic acid
• 2-Chloro-3-nitro-5-pyridinecarboxylic acid

6-Chloro-5-nitronicotinic acid

CAS: 7477-10-3

Formula: C₆H₃ClN₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 202.5520

Ref: IN-DA00337M

6-Chloro-5-nitronicotinic acid

CAS: 7477-10-3

6-Chloro-5-nitronicotinic acid

Formula: C₆H₃ClN₂O₄

Purity: 98%

Color and Shape: Yellow Powder

Molecular weight: 202.55g/mol

Ref: 54-OR3496

6-Chloro-5-nitronicotinic acid

CAS: 7477-10-3

Formula: C₆H₃ClN₂O₄

Purity: 95%

Color and Shape: Solid, Yellow powder

Molecular weight: 202.55

Ref: 10-F079563