CymitQuimica logo

CAS 7478-65-1

:

(2E)-1-(2-hydroxy-3,4-dimethoxyphenyl)-3-phenylprop-2-en-1-one

Description:
The chemical substance known as (2E)-1-(2-hydroxy-3,4-dimethoxyphenyl)-3-phenylprop-2-en-1-one, with the CAS number 7478-65-1, is a type of chalcone, which is a class of compounds characterized by a specific structure featuring a phenyl group and an α,β-unsaturated carbonyl moiety. This compound exhibits notable features such as a conjugated double bond system, which contributes to its potential biological activity, including antioxidant and anti-inflammatory properties. The presence of hydroxyl and methoxy groups on the aromatic ring enhances its solubility and reactivity, making it of interest in various fields, including medicinal chemistry and natural product synthesis. Additionally, chalcones are known for their ability to undergo various chemical transformations, such as cyclization and oxidation, which can lead to the formation of more complex structures. Overall, this compound's unique structural characteristics and functional groups make it a subject of interest for further research in pharmacology and organic synthesis.
Formula:C17H16O4
InChI:InChI=1/C17H16O4/c1-20-15-11-9-13(16(19)17(15)21-2)14(18)10-8-12-6-4-3-5-7-12/h3-11,19H,1-2H3/b10-8+
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.