
CAS 7478-88-8
:3-({[4-(acetylamino)phenyl]sulfonyl}amino)propanoate
Description:
3-({[4-(Acetylamino)phenyl]sulfonyl}amino)propanoate, with the CAS number 7478-88-8, is a chemical compound characterized by its complex structure that includes an acetylamino group, a sulfonyl moiety, and a propanoate functional group. This compound typically exhibits properties associated with both amines and carboxylic acids, making it potentially useful in various biochemical applications. The presence of the sulfonyl group suggests that it may have good solubility in polar solvents, while the acetylamino group can influence its reactivity and interaction with biological systems. Additionally, the compound may exhibit specific biological activities, which could be of interest in pharmaceutical research. Its molecular structure allows for potential interactions with proteins or enzymes, making it a candidate for further studies in medicinal chemistry. As with many organic compounds, its stability, reactivity, and solubility can vary based on environmental conditions such as pH and temperature.
Formula:C11H13N2O5S
InChI:InChI=1/C11H14N2O5S/c1-8(14)13-9-2-4-10(5-3-9)19(17,18)12-7-6-11(15)16/h2-5,12H,6-7H2,1H3,(H,13,14)(H,15,16)/p-1
SMILES:CC(=Nc1ccc(cc1)S(=O)(=O)NCCC(=O)O)[O-]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
