CAS 74784-20-6

(6Z,9Z,11E,13S)-13-hydroxyoctadeca-6,9,11-trienoic acid

Description:

(6Z,9Z,11E,13S)-13-hydroxyoctadeca-6,9,11-trienoic acid, commonly known as 13-hydroxyoctadecatrienoic acid (HOTE), is a polyunsaturated fatty acid characterized by its long carbon chain and multiple double bonds. It features a hydroxyl group at the 13th carbon position, which contributes to its reactivity and potential biological activity. The specific configuration of the double bonds (6Z, 9Z, and 11E) indicates the geometric isomerism, which can influence the compound's physical and chemical properties, such as melting point and solubility. HOTE is known to play a role in various biological processes, including inflammation and cell signaling, and is studied for its potential therapeutic applications. Its presence in biological systems can affect membrane fluidity and the synthesis of bioactive lipids. As a fatty acid, it is typically found in lipid-rich environments and can be derived from dietary sources or synthesized in the body. Overall, its unique structure and properties make it a subject of interest in both biochemistry and nutrition.

Formula: C₁₈H₃₀O₃

InChI: InChI=1/C18H30O3/c1-2-3-11-14-17(19)15-12-9-7-5-4-6-8-10-13-16-18(20)21/h4,6-7,9,12,15,17,19H,2-3,5,8,10-11,13-14,16H2,1H3,(H,20,21)/b6-4-,9-7-,15-12+/t17-/m0/s1

13(S)-Hydroxy-6(Z),9(Z),11(E)-octadecatrienoic acid

CAS: 74784-20-6

Formula: C18H30O3

Purity: >98%

Color and Shape: Liquid

Molecular weight: 294.43

Ref: 48-14-1870

13(S)-HOTrE(γ)

CAS: 74784-20-6

13(S)-HOTrE(γ) is a metabolite and octadecatrienoic acid used as a metabolic marker, in the study of metabolic disorders and neurological diseases.

Formula: C₁₈H₃₀O₃

Color and Shape: Solid

Molecular weight: 294.43

Ref: TM-T37976