CymitQuimica logo

CAS 74784-47-7

:

5-(2-aminoethyl)-1,3,4-thiadiazol-2-amine

Description:
5-(2-aminoethyl)-1,3,4-thiadiazol-2-amine, with the CAS number 74784-47-7, is a heterocyclic compound featuring a thiadiazole ring, which is characterized by the presence of sulfur and nitrogen atoms. This compound typically exhibits properties associated with its functional groups, including potential basicity due to the amino groups. The presence of the thiadiazole moiety suggests that it may have biological activity, as many thiadiazole derivatives are known for their pharmacological properties. The aminoethyl side chain can enhance solubility in polar solvents and may contribute to the compound's reactivity and interaction with biological targets. Additionally, this compound may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions, due to the presence of the amino and thiadiazole functionalities. Its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 5-(2-aminoethyl)-1,3,4-thiadiazol-2-amine is of interest in medicinal chemistry and may serve as a scaffold for the development of new therapeutic agents.
Formula:C4H8N4S
InChI:InChI=1/C4H8N4S/c5-2-1-3-7-8-4(6)9-3/h1-2,5H2,(H2,6,8)
SMILES:C(CN)c1n[nH]c(=N)s1
Synonyms:
  • 1,3,4-Thiadiazole-2-Ethanamine, 5-Amino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.