CAS 74785-02-7

[2-(bromomethyl)phenyl]methanol

Description:

[2-(Bromomethyl)phenyl]methanol, with the CAS number 74785-02-7, is an organic compound characterized by the presence of a bromomethyl group attached to a phenyl ring, along with a hydroxymethyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents such as ethanol and dichloromethane but may have limited solubility in water due to its hydrophobic phenyl group. The presence of the bromine atom makes it a potential electrophile, allowing it to participate in various chemical reactions, including nucleophilic substitutions. The hydroxymethyl group contributes to its reactivity, enabling it to undergo further transformations, such as oxidation or etherification. Safety precautions should be taken when handling this compound, as brominated compounds can be hazardous. Overall, [2-(bromomethyl)phenyl]methanol serves as an important intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals.

Formula: C₈H₉BrO

InChI: InChI=1/C8H9BrO/c9-5-7-3-1-2-4-8(7)6-10/h1-4,10H,5-6H2

SMILES: c1ccc(CO)c(c1)CBr

(2-(Bromomethyl)phenyl)methanol

CAS: 74785-02-7

Formula: C₈H₉BrO

Purity: 96%

Color and Shape: Solid

Molecular weight: 201.0605

Ref: IN-DA003F01

(2-(Bromomethyl)phenyl)methanol

CAS: 74785-02-7

(2-(Bromomethyl)phenyl)methanol

Purity: 97%

Molecular weight: 201.06g/mol

Ref: 54-OR92225

(2-(Bromomethyl)phenyl)methanol

CAS: 74785-02-7

Formula: C₈H₉BrO

Purity: 95%

Color and Shape: Solid

Molecular weight: 201.063

Ref: 10-F320947

(2-(Bromomethyl)phenyl)methanol

CAS: 74785-02-7

(2-(Bromomethyl)phenyl)methanol is an acceptor of a palladium complex. It is used in the synthesis of amides and other functional groups, as well as in catalysis. 2-(Bromomethyl)phenyl)methanol can be quaternized with methyl iodide to form a bromoalkylamine. The reaction proceeds via an amide group on the bromoalkylamine and a hydrogen atom from the alkyl halide. This process is known as "supramolecular" or "intermolecular" hydrogen bonding. It has been found that 2-(Bromomethyl)phenyl)methanol forms complexes with palladium through intermolecular hydrogen bonding, which are more stable than those formed by other ligands such as phosphines and cyanides.

Formula: C₈H₉BrO

Purity: 95%Nmr

Molecular weight: 201.06 g/mol

Ref: 3D-FB139993