CAS 74788-82-2
:2,6-Dimethylbenzylamine
Description:
2,6-Dimethylbenzylamine is an organic compound characterized by its structure, which features a benzene ring substituted with two methyl groups at the 2 and 6 positions, and an amine group attached to a benzyl group. This compound is typically a colorless to pale yellow liquid with a distinctive amine odor. It is soluble in organic solvents and exhibits limited solubility in water due to its hydrophobic aromatic structure. 2,6-Dimethylbenzylamine is known for its basicity, which is attributed to the presence of the amine functional group, making it a potential candidate for various chemical reactions, including as a catalyst or a building block in organic synthesis. Additionally, it may be used in the production of polymers, pharmaceuticals, and agrochemicals. Safety considerations include its potential irritant effects on skin and eyes, and appropriate handling measures should be taken to minimize exposure. As with many amines, it may also undergo oxidation or react with acids to form salts.
Formula:C9H13N
InChI:InChI=1/C9H13N/c1-7-4-3-5-8(2)9(7)6-10/h3-5H,6,10H2,1-2H3
SMILES:Cc1cccc(C)c1CN
Synonyms:- 1-(2,6-Dimethylphenyl)methanamine
- Benzenemethanamine, 2,6-dimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,6-Dimethylbenzylamine
CAS:2,6-DimethylbenzylamineFormula:C9H13NPurity:98%Color and Shape: clear. colourless to very faint yellow liquidMolecular weight:135.20621g/mol2,6-Dimethylbenzylamine
CAS:<p>2,6-Dimethylbenzylamine is a chemical compound that has been shown to have potent antiviral activity. It binds to the active site of the HIV-1 protease enzyme, which blocks the cleavage of polyproteins into functional proteins. In addition, 2,6-dimethylbenzylamine has been shown to be capable of blocking other enzymes such as human immunodeficiency virus (HIV)-1 integrase and influenza virus neuraminidase. The chemical structure of 2,6-dimethylbenzylamine includes a heterocyclic ring that may be modified to optimise its antiviral activity. This modification can be done by using peptidomimetics or bioactive molecules such as small molecules or lipids.</p>Formula:C9H13NPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:135.21 g/mol
