CAS 7479-08-5
:N-benzyl-O-methyltyrosinamide
Description:
N-benzyl-O-methyltyrosinamide, with the CAS number 7479-08-5, is an organic compound that features a structure derived from the amino acid tyrosine. This compound is characterized by the presence of a benzyl group and a methoxy group attached to the nitrogen and oxygen atoms, respectively. It is typically classified as an amide due to the presence of the amide functional group, which is formed by the reaction of an amine with a carboxylic acid. The compound exhibits properties such as solubility in organic solvents, which is common for many amides, and it may show biological activity due to its structural similarity to neurotransmitters and hormones. Its potential applications could span various fields, including medicinal chemistry and biochemistry, where it may serve as a precursor or intermediate in the synthesis of more complex molecules. However, specific details regarding its reactivity, stability, and biological effects would require further investigation and empirical data.
Formula:C17H20N2O2
InChI:InChI=1/C17H20N2O2/c1-21-15-9-7-13(8-10-15)11-16(18)17(20)19-12-14-5-3-2-4-6-14/h2-10,16H,11-12,18H2,1H3,(H,19,20)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.