CAS 74798-64-4

1-(2-Amino-3-bromophenyl)-2-chloroethanone

Description:

1-(2-Amino-3-bromophenyl)-2-chloroethanone, with the CAS number 74798-64-4, is an organic compound characterized by its functional groups and structural features. It contains an amino group (-NH2), a bromophenyl moiety, and a chloroethanone group, which contribute to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic character, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The chloroethanone part of the molecule indicates that it can participate in reactions typical of carbonyl compounds, such as condensation and acylation. This compound may exhibit biological activity due to the amino group, which can interact with biological targets. Its physical properties, such as solubility and melting point, would depend on the specific molecular interactions and the presence of substituents. Overall, 1-(2-Amino-3-bromophenyl)-2-chloroethanone is a versatile compound with potential applications in pharmaceuticals and agrochemicals.

Formula: C₈H₇BrClNO

InChI: InChI=1S/C8H7BrClNO/c9-6-3-1-2-5(8(6)11)7(12)4-10/h1-3H,4,11H2

InChI key: InChIKey=OCPNCQZVEODSIV-UHFFFAOYSA-N

SMILES: C(CCl)(=O)C1=C(N)C(Br)=CC=C1

Synonyms:

• Ethanone, 1-(2-amino-3-bromophenyl)-2-chloro-
• 1-(2-Amino-3-bromophenyl)-2-chloroethan-1-one
• 1-(2-Amino-3-bromophenyl)-2-chloroethanone