
CAS 7480-80-0
:5-Methyl-1H-indene
Description:
5-Methyl-1H-indene is an organic compound characterized by its bicyclic structure, which consists of a fused benzene and cyclopentene ring. It is a colorless to pale yellow liquid at room temperature and has a distinctive aromatic odor. The compound is classified as an indene derivative, with a methyl group attached to the fifth carbon of the indene structure. Its molecular formula is C10H10, and it exhibits properties typical of aromatic hydrocarbons, including stability and relatively low reactivity under standard conditions. 5-Methyl-1H-indene is soluble in organic solvents such as ethanol and ether but has limited solubility in water. It is primarily used in organic synthesis and as an intermediate in the production of various chemical compounds. Additionally, it may be involved in polymerization reactions, contributing to the development of specialty materials. Safety data indicates that, like many organic solvents, it should be handled with care due to potential health hazards, including skin and respiratory irritation.
Formula:C10H10
InChI:InChI=1S/C10H10/c1-8-5-6-9-3-2-4-10(9)7-8/h2,4-7H,3H2,1H3
InChI key:InChIKey=YLHSETDFVAXPRB-UHFFFAOYSA-N
SMILES:CC=1C=C2C(=CC1)CC=C2
Synonyms:- 5-Methyl-1H-inden
- 5-Methyl-1H-indene
- 5-Methylindene
- Indene, 5-methyl-
- 1H-Indene, 5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.