CAS 74801-29-9
:(3S,6S)-3,4,5-tribenzyloxy-2-(benzyloxymethyl)-6-phenylsulfanyl-tetrahydropyran
Description:
The chemical substance known as (3S,6S)-3,4,5-tribenzyloxy-2-(benzyloxymethyl)-6-phenylsulfanyl-tetrahydropyran, with the CAS number 74801-29-9, is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple benzyloxy groups, indicating the presence of benzyl ether functionalities that enhance its solubility and reactivity. The phenylsulfanyl group introduces a sulfur atom into the structure, which can influence the compound's chemical properties, such as its reactivity and potential for forming coordination complexes. The stereochemistry, denoted by the (3S,6S) configuration, suggests specific spatial arrangements of the substituents, which can significantly affect the compound's biological activity and interaction with other molecules. Overall, this substance may exhibit interesting properties for applications in organic synthesis, medicinal chemistry, or as a potential intermediate in the development of pharmaceuticals, although specific biological or chemical activities would require further investigation.
Formula:C40H40O5S
InChI:InChI=1/C40H40O5S/c1-6-16-31(17-7-1)26-41-30-36-37(42-27-32-18-8-2-9-19-32)38(43-28-33-20-10-3-11-21-33)39(44-29-34-22-12-4-13-23-34)40(45-36)46-35-24-14-5-15-25-35/h1-25,36-40H,26-30H2/t36?,37-,38?,39?,40-/m0/s1
SMILES:c1ccc(cc1)COCC1[C@@H](C(C([C@@H](O1)Sc1ccccc1)OCc1ccccc1)OCc1ccccc1)OCc1ccccc1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Phenyl 2,3,4,6-Tetra-O-benzyl-1-thio-β-D-galactopyranoside
CAS:Formula:C40H40O5SPurity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:632.82(2R,3S,4S,5R,6S)-3,4,5-Tris(benzyloxy)-2-((benzyloxy)methyl)-6-(phenylthio)tetrahydro-2H-pyran
CAS:(2R,3S,4S,5R,6S)-3,4,5-Tris(benzyloxy)-2-((benzyloxy)methyl)-6-(phenylthio)tetrahydro-2H-pyranPurity:95%Molecular weight:632.82g/molPhenyl 2,3,4,6-tetra-O-benzyl-b-D-thiogalactopyranoside
CAS:<p>The chemical name for Phenyl 2,3,4,6-tetra-O-benzyl-b-D-thiogalactopyranoside is Phenyl 2,3,4,6-tetra-O-benzyl-b-D-thiogalactopyranoside. This chemical is a Carbohydrate that is Modification and saccharide. It has the molecular formula of C12H14O8S2. Phenyl 2,3,4,6-tetra-O-benzyl-b-D-thiogalactopyranoside is an Oligosaccharide with a sugar type of Monosaccharide. The Chemical Abstracts Service (CAS) registry number for this chemical is 577861 - 19 - 1. Phenyl 2,3,4,6 tetra O benzyl b D thiogalactop</p>Formula:C40H40O5SPurity:Min. 95%Color and Shape:PowderMolecular weight:632.81 g/mol





