
CAS 74805-60-0
:(5Z)-5-(Phenylmethylene)-2,4-imidazolidinedione
Description:
(5Z)-5-(Phenylmethylene)-2,4-imidazolidinedione, also known as phenylmethylene-2,4-imidazolidinedione, is a chemical compound characterized by its imidazolidinedione structure, which features a five-membered ring containing two nitrogen atoms and two carbonyl groups. This compound typically exhibits a solid state at room temperature and is known for its potential applications in medicinal chemistry, particularly as a building block in the synthesis of various pharmaceuticals. The presence of the phenylmethylene group contributes to its reactivity and may influence its biological activity. The compound is likely to be soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the phenyl group. Additionally, it may exhibit tautomeric behavior due to the presence of the carbonyl groups, which can affect its chemical properties and interactions. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C10H8N2O2
InChI:InChI=1S/C10H8N2O2/c13-9-8(11-10(14)12-9)6-7-4-2-1-3-5-7/h1-6H,(H2,11,12,13,14)/b8-6-
InChI key:InChIKey=UDTSPKADQGPZFS-VURMDHGXSA-N
SMILES:C(=C\1/C(=O)NC(=O)N1)\C2=CC=CC=C2
Synonyms:- 2,4-Imidazolidinedione, 5-(phenylmethylene)-, (5Z)-
- 2,4-Imidazolidinedione, 5-(phenylmethylene)-, (Z)-
- (5Z)-5-(Phenylmethylene)-2,4-imidazolidinedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
