CAS 74805-92-8
:Methylophiopogonanone A
Description:
Methylophiopogonanone A is a natural compound classified as a phenolic compound, primarily derived from the plant Ophiopogon japonicus, commonly known for its traditional medicinal uses. This compound exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. Methylophiopogonanone A is characterized by its unique chemical structure, which includes a methyl group and a phenolic moiety, contributing to its reactivity and interaction with biological systems. The compound is typically studied for its effects on various cellular pathways and its potential therapeutic applications. Additionally, it may possess properties that enhance the efficacy of other compounds when used in combination therapies. As with many natural products, the extraction and purification processes are crucial for obtaining Methylophiopogonanone A in sufficient quantities for research and potential clinical applications. Its safety profile and bioavailability are also important factors to consider in the context of its use in health-related applications.
Formula:C19H18O6
InChI:InChI=1S/C19H18O6/c1-9-16(20)10(2)19-15(17(9)21)18(22)12(7-23-19)5-11-3-4-13-14(6-11)25-8-24-13/h3-4,6,12,20-21H,5,7-8H2,1-2H3/t12-/m1/s1
InChI key:InChIKey=BXTNNJIQILYHJB-GFCCVEGCSA-N
SMILES:O=C1C=2C(=C(C)C(O)=C(C)C2O)OC[C@H]1CC=3C=C4C(=CC3)OCO4
Synonyms:- 4H-1-Benzopyran-4-one, 3-(1,3-benzodioxol-5-ylmethyl)-2,3-dihydro-5,7-dihydroxy-6,8-dimethyl-, (3R)-
- R-Methylophiopogonanone A
- NE-III
- Methylophiopogonanone A
- (3R)-3-(1,3-Benzodioxol-5-ylmethyl)-2,3-dihydro-5,7-dihydroxy-6,8-dimethyl-4H-1-benzopyran-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Methylophiopogonanone A
CAS:Methylophiopogonanone A may treat cerebral I/R injury by reducing inflammation, oxidative stress, and protecting the blood-brain barrier.Formula:C19H18O6Purity:99.78% - 99.99%Color and Shape:SolidMolecular weight:342.34Ref: TM-T5S1262
1mg58.00€5mg126.00€10mg222.00€25mg376.00€50mg535.00€100mg775.00€1mL*10mM (DMSO)133.00€Methylophiopogonanone a
CAS:Oxygen-heterocyclic compoundFormula:C19H18O6Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:342.34Methylophiopogonanone A
CAS:Methylophiopogonanone A is a versatile building block that can be used in the synthesis of complex compounds. It is also a reagent, speciality chemical and useful scaffold for the synthesis of more complex molecules. Methylophiopogonanone A is a high-quality, useful intermediate and reaction component that can be used in the synthesis of various pharmaceuticals. This compound has a CAS number of 74805-92-8 and belongs to the category of research chemicals.
Formula:C19H18O6Molecular weight:342.34 g/mol






