CymitQuimica logo

CAS 748128-13-4

:

Benzenepropanoic acid, b-amino-2,3-dichloro-, (bS)-

Description:
Benzenepropanoic acid, b-amino-2,3-dichloro-, (bS)-, also known by its CAS number 748128-13-4, is an organic compound characterized by its aromatic benzene ring and a propanoic acid functional group. This compound features a b-amino group, indicating the presence of an amino group attached to the beta carbon of the propanoic acid chain. The presence of two chlorine atoms at the 2 and 3 positions of the carbon chain contributes to its dichloro designation, influencing its reactivity and potential biological activity. The (bS)- notation indicates the specific stereochemistry of the molecule, which can affect its interaction with biological systems and its overall properties. Benzenepropanoic acid derivatives are often studied for their potential applications in pharmaceuticals and agrochemicals due to their ability to interact with various biological targets. The compound's solubility, melting point, and other physical properties would depend on its specific structure and the presence of functional groups, making it relevant in both synthetic and medicinal chemistry contexts.
Formula:C9H9Cl2NO2
InChI:InChI=1S/C9H9Cl2NO2/c10-6-3-1-2-5(9(6)11)7(12)4-8(13)14/h1-3,7H,4,12H2,(H,13,14)/t7-/m0/s1
InChI key:GQKLESLYMHWBOP-ZETCQYMHSA-N
SMILES:C1=CC(=C(C(=C1)Cl)Cl)[C@H](CC(=O)O)N
Synonyms:
  • H-Beta-Phe(2,3-Dicl)-Oh
  • H-D-Phg(2,3-Cl 2)-(C*Ch2)Oh
  • Rarechem Lk Hc T314
  • (S)-3-Amino-3-(2,3-Dichloro-Phenyl)-Propionic Acid
  • H-b-Phe(2,3-DiCl)-OH
Found 4 products.