CymitQuimica logo

CAS 74815-18-2

:

5-Ethyl-3(2H)-benzofuranone

Description:
5-Ethyl-3(2H)-benzofuranone, also known by its CAS number 74815-18-2, is an organic compound characterized by its unique structure that combines a benzofuran moiety with an ethyl group. This compound typically exhibits a colorless to pale yellow appearance and is known for its pleasant, sweet, and fruity aroma, making it of interest in the fragrance and flavor industries. It has a relatively low molecular weight and is soluble in organic solvents, which enhances its utility in various applications. The compound is stable under normal conditions but may undergo reactions typical of carbonyl-containing compounds, such as nucleophilic addition. Its chemical properties allow it to participate in various synthetic pathways, making it a valuable intermediate in organic synthesis. Additionally, 5-Ethyl-3(2H)-benzofuranone may exhibit biological activity, although specific pharmacological effects would require further investigation. Overall, its distinctive structure and properties contribute to its relevance in both industrial and research contexts.
Formula:C10H10O2
InChI:InChI=1S/C10H10O2/c1-2-7-3-4-10-8(5-7)9(11)6-12-10/h3-5H,2,6H2,1H3
InChI key:InChIKey=CHBGURUPOWAZFK-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC=C(CC)C2)OC1
Synonyms:
  • 5-Ethyl-3(2H)-benzofuranone
  • 3(2H)-Benzofuranone, 5-ethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.