CAS 748187-71-5

1-{Isocyano[(4-methylphenyl)sulfonyl]methyl}-4-(trifluoromethyl)benzene

Description:

1-{Isocyano[(4-methylphenyl)sulfonyl]methyl}-4-(trifluoromethyl)benzene, with the CAS number 748187-71-5, is a chemical compound characterized by its unique functional groups and structural features. It contains an isocyanide functional group, which is known for its reactivity and ability to participate in various organic reactions, including the formation of carbon-nitrogen bonds. The presence of a sulfonyl group attached to a 4-methylphenyl moiety enhances its electrophilic character, making it useful in synthetic applications. Additionally, the trifluoromethyl group contributes to the compound's lipophilicity and can influence its biological activity and solubility. This compound is likely to exhibit interesting properties due to the combination of these functional groups, including potential applications in medicinal chemistry, materials science, or as an intermediate in organic synthesis. Its stability, reactivity, and interactions with other chemical species would depend on the specific conditions under which it is used, such as temperature, solvent, and the presence of catalysts.

Formula: C₁₆H₁₂F₃NO₂S

InChI: InChI=1/C16H12F3NO2S/c1-11-3-9-14(10-4-11)23(21,22)15(20-2)12-5-7-13(8-6-12)16(17,18)19/h3-10,15H,1H3

SMILES: Cc1ccc(cc1)S(=O)(=O)C(c1ccc(cc1)C(F)(F)F)[N+]#[C-]

1-{Isocyano[4-(trifluoromethyl)phenyl]methanesulfonyl}-4-methylbenzene

CAS: 748187-71-5

1-{Isocyano[4-(trifluoromethyl)phenyl]methanesulfonyl}-4-methylbenzene

Molecular weight: 339.33219g/mol

Ref: 54-PC106512

[1-(4-TRIFLUOROMETHYLPHENYL)-1-TOSYL]METHYL ISOCYANIDE

CAS: 748187-71-5

Formula: C₁₆H₁₂F₃NO₂S

Purity: 95.0%

Molecular weight: 339.33

Ref: 10-F470639