CymitQuimica logo

CAS 748188-88-7

:

5-Fluoro-2-iodobenzamide

Description:
5-Fluoro-2-iodobenzamide is an organic compound characterized by the presence of a benzene ring substituted with both a fluorine atom and an iodine atom, along with an amide functional group. The fluorine atom is located at the 5-position, while the iodine is at the 2-position of the benzene ring. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its unique electronic and steric properties. The presence of halogens like fluorine and iodine can influence the compound's reactivity and biological activity, making it a subject of interest in drug design. Additionally, 5-Fluoro-2-iodobenzamide may exhibit specific solubility characteristics, stability under various conditions, and distinct spectral properties that can be analyzed using techniques such as NMR and mass spectrometry. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental impact.
Formula:C7H5FINO
InChI:InChI=1S/C7H5FINO/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H2,10,11)
InChI key:InChIKey=IAHFLUGPJZSBQZ-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C(I)C=CC(F)=C1
Synonyms:
  • Benzamide, 5-fluoro-2-iodo-
  • 5-Fluoro-2-iodobenzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.