
CAS 7483-32-1
:2-Quinoxalinecarboxaldehyde, oxime
Description:
2-Quinoxalinecarboxaldehyde oxime, with the CAS number 7483-32-1, is an organic compound characterized by the presence of both a quinoxaline ring and an oxime functional group. This compound typically appears as a crystalline solid and is known for its potential applications in various fields, including pharmaceuticals and organic synthesis. The oxime functional group, characterized by the presence of a hydroxylamine (-C=N-OH) moiety, imparts specific reactivity, making it useful in the formation of other chemical derivatives. The compound may exhibit moderate solubility in polar solvents, and its reactivity can be influenced by the electronic properties of the quinoxaline moiety. Additionally, 2-Quinoxalinecarboxaldehyde oxime may possess biological activity, which has been the subject of research in medicinal chemistry. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature. Overall, this compound serves as an interesting subject for further investigation in both synthetic and applied chemistry contexts.
Formula:C9H7N3O
InChI:InChI=1S/C9H7N3O/c13-11-6-7-5-10-8-3-1-2-4-9(8)12-7/h1-6,13H
InChI key:InChIKey=HVEUVILQUUKSFP-UHFFFAOYSA-N
SMILES:C(=NO)C1=NC2=C(N=C1)C=CC=C2
Synonyms:- 2-Quinoxalinecarboxaldehyde, oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.