CAS 74840-47-4
:5-chloro-2-methylpyrimidine-4-carboxylic acid
Description:
5-Chloro-2-methylpyrimidine-4-carboxylic acid is a heterocyclic organic compound characterized by a pyrimidine ring structure that includes a chlorine atom and a carboxylic acid functional group. The presence of the chlorine atom at the 5-position and a methyl group at the 2-position of the pyrimidine ring contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar solvents, which is common for carboxylic acids. It exhibits acidic behavior due to the carboxylic acid group, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, its structural features make it a potential candidate for applications in pharmaceuticals and agrochemicals, where pyrimidine derivatives are often explored for their biological activity. The compound's reactivity can be influenced by the electron-withdrawing nature of the chlorine atom, which can affect its interaction with nucleophiles in synthetic pathways. Overall, 5-chloro-2-methylpyrimidine-4-carboxylic acid is a versatile compound with significant implications in organic synthesis and medicinal chemistry.
Formula:C6H5ClN2O2
InChI:InChI=1/C6H5ClN2O2/c1-3-8-2-4(7)5(9-3)6(10)11/h2H,1H3,(H,10,11)
SMILES:Cc1ncc(c(C(=O)O)n1)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Chloro-2-methylpyrimidine-4-carboxylic acid
CAS:Formula:C6H5ClN2O2Purity:97%Color and Shape:SolidMolecular weight:172.56915-Chloro-2-methylpyrimidine-4-carboxylic acid
CAS:5-Chloro-2-methylpyrimidine-4-carboxylic acidPurity:95%Color and Shape:SolidMolecular weight:172.57g/mol5-Chloro-2-methylpyrimidine-4-carboxylic acid
CAS:Formula:C6H5ClN2O2Purity:≥97%Color and Shape:SolidMolecular weight:172.575-Chloro-2-methylpyrimidine-4-carboxylic acid
CAS:5-Chloro-2-methylpyrimidine-4-carboxylic acid is a versatile compound that has various applications in different industries. It is commonly used in the production of antibodies, lysine, herbicides, and fatty acids. Additionally, it can act as a metallic catalyst and an antibiotic. This compound also plays a role in the synthesis of disaccharides, pyrazole derivatives, electrolytes, and chloride salts.Formula:C6H5ClN2O2Purity:Min. 95%Molecular weight:172.57 g/mol



