CAS 74849-11-9

4-(Acetyloxy)-3-bromobenzaldehyde

Description:

4-(Acetyloxy)-3-bromobenzaldehyde is an organic compound characterized by its functional groups, which include an aldehyde, an acetyloxy group, and a bromine atom attached to a benzene ring. The presence of the aldehyde group (-CHO) indicates that it can participate in various chemical reactions, such as oxidation and condensation. The acetyloxy group (-OCOCH3) suggests that the compound can undergo hydrolysis or esterification reactions. The bromine atom introduces a halogen, which can enhance the compound's reactivity and influence its physical properties, such as solubility and boiling point. Typically, compounds like this exhibit moderate to high polarity due to the electronegative bromine and the carbonyl oxygen in the aldehyde. The molecular structure contributes to its potential applications in organic synthesis, pharmaceuticals, and as an intermediate in the production of other chemical compounds. Safety data should be consulted for handling, as halogenated compounds can pose health risks.

Formula: C₉H₇BrO₃

InChI: InChI=1S/C9H7BrO3/c1-6(12)13-9-3-2-7(5-11)4-8(9)10/h2-5H,1H3

InChI key: InChIKey=PIKBROCSQAGBGX-UHFFFAOYSA-N

SMILES: O(C(C)=O)C1=C(Br)C=C(C=O)C=C1

Synonyms:

• 4-(Acetyloxy)-3-bromobenzaldehyde
• Benzaldehyde, 4-(acetyloxy)-3-bromo-
• 2-Bromo-4-formylphenyl acetate

2-Bromo-4-formylphenyl acetate

CAS: 74849-11-9

2-Bromo-4-formylphenyl acetate

Purity: 95%

Molecular weight: 243.057g/mol

Ref: 54-OR97787