CAS 74852-62-3
:4-[4-(4-Methoxyphenyl)-1-piperazinyl]benzenamine
Description:
4-[4-(4-Methoxyphenyl)-1-piperazinyl]benzenamine, with the CAS number 74852-62-3, is an organic compound characterized by its complex structure that includes a piperazine ring and aromatic amine functionalities. This compound features a methoxy group attached to a phenyl ring, which contributes to its lipophilicity and potential biological activity. The presence of the piperazine moiety suggests possible interactions with neurotransmitter receptors, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and purity of the sample. Additionally, safety data should be consulted, as compounds with similar structures may exhibit varying levels of toxicity or environmental impact. Overall, this compound represents a class of molecules that could have significant implications in drug discovery and development.
Formula:C17H21N3O
InChI:InChI=1S/C17H21N3O/c1-21-17-8-6-16(7-9-17)20-12-10-19(11-13-20)15-4-2-14(18)3-5-15/h2-9H,10-13,18H2,1H3
InChI key:InChIKey=VXEGSRKPIUDPQT-UHFFFAOYSA-N
SMILES:O(C)C1=CC=C(N2CCN(CC2)C3=CC=C(N)C=C3)C=C1
Synonyms:- 1-(4-Amino Phenyl)-4-(4-Methoxy Phenyl) Piperazine
- 1-(4-Aminophenyl)-4-(4-methoxyphenyl)piperazine
- 4-[4-(4-Methoxyphenyl)-1-piperazinyl]benzenamine
- 4-[4-(4-Methoxyphenyl)Piperazin-1-Yl]Aniline
- Benzenamine, 4-[4-(4-methoxyphenyl)-1-piperazinyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
1-(4-Aminophenyl)-4-(4-methoxyphenyl)piperazine
CAS:Formula:C17H21N3OPurity:>96.0%(T)(HPLC)Color and Shape:Yellow to Amber to Dark red powder to crystalMolecular weight:283.384-[4-(4-methoxyphenyl)piperazin-1-yl]aniline
CAS:Formula:C17H21N3OPurity:96%Color and Shape:SolidMolecular weight:283.36814-[4-(4-Methoxyphenyl)piperazin-1-yl]aniline
CAS:4-[4-(4-Methoxyphenyl)piperazin-1-yl]anilinePurity:96%Molecular weight:283.37g/mol4-(4-(4-Methoxyphenyl)piperazin-1-yl)aniline
CAS:Formula:C17H21N3OPurity:≥96%Molecular weight:283.3754-[4-(4-Methyloxy-phenyl)-piperazin-1-yl]-phenylamine
CAS:Controlled Product<p>Applications 4-[4-(4-Methyloxy-phenyl)-piperazin-1-yl]-phenylamine, is an intermediate for the synthesis of Itraconazole (I937500), an Antifungal.<br></p>Formula:C17H21N3OColor and Shape:NeatMolecular weight:283.374-[4-(4-Methyloxy-phenyl)-piperazin-1-yl]-phenylamine
CAS:<p>4-Methyloxy-phenyl)-piperazin-1-yl]-phenylamine is an organic compound that has a reactive silicon group. It contains two phenyl groups, one of which is attached to the silicon. This compound exhibits phase equilibrium in water and can be used as a monomer for fabricating inorganic materials with orderly patterns, such as glass and metal oxides. This product also has impurities and can be grown at different rates depending on the conditions, such as temperature. The optical properties of 4-methyloxy-phenyl)-piperazin-1-yl]-phenylamine are dependent on its environment and it has been shown to have exothermic properties when reacting with iron powder.</p>Formula:C17H21N3OPurity:Min. 95%Molecular weight:283.37 g/mol







