CymitQuimica logo

CAS 74853-62-6

:

N,1-ditritylhistidine

Description:
N,1-Ditritylhistidine is a modified amino acid derivative of histidine, characterized by the presence of two trityl (triphenylmethyl) protecting groups attached to the nitrogen and the alpha carbon of the histidine side chain. This compound is typically utilized in peptide synthesis and biochemistry due to its ability to protect the amino group and the imidazole side chain of histidine, which can be reactive under certain conditions. The trityl groups enhance the stability and solubility of the compound, making it easier to handle in synthetic processes. N,1-Ditritylhistidine is often employed in the synthesis of peptides where selective deprotection is required, allowing for the controlled release of the functional groups at specific stages of the synthesis. Additionally, its structural features contribute to its role in studies involving protein folding and interactions, as well as in the development of pharmaceuticals. As with many chemical substances, proper handling and storage conditions are essential to maintain its integrity and reactivity.
Formula:C44H37N3O2
InChI:InChI=1/C44H37N3O2/c48-42(49)41(46-43(34-19-7-1-8-20-34,35-21-9-2-10-22-35)36-23-11-3-12-24-36)31-40-32-47(33-45-40)44(37-25-13-4-14-26-37,38-27-15-5-16-28-38)39-29-17-6-18-30-39/h1-30,32-33,41,46H,31H2,(H,48,49)
SMILES:c1ccc(cc1)C(c1ccccc1)(c1ccccc1)NC(Cc1cn(cn1)C(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.