CAS 74859-51-1

2-[(4-ethoxyphenyl)amino]-4-nitrobenzoic acid

Description:

2-[(4-Ethoxyphenyl)amino]-4-nitrobenzoic acid, with the CAS number 74859-51-1, is an organic compound characterized by its complex structure, which includes an amino group, a nitro group, and a benzoic acid moiety. This compound typically appears as a solid and is soluble in organic solvents, while its solubility in water may vary depending on pH. The presence of the ethoxy group enhances its lipophilicity, potentially influencing its biological activity and interactions. The nitro group is known for its electron-withdrawing properties, which can affect the reactivity of the compound in various chemical reactions. This substance may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs or as a chemical probe. Its synthesis usually involves multi-step organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. Safety data should be consulted for handling and potential hazards associated with this compound.

Formula: C₁₅H₁₄N₂O₅

InChI: InChI=1/C15H14N2O5/c1-2-22-12-6-3-10(4-7-12)16-14-9-11(17(20)21)5-8-13(14)15(18)19/h3-9,16H,2H2,1H3,(H,18,19)

SMILES: CCOc1ccc(cc1)Nc1cc(ccc1C(=O)O)N(=O)=O

Synonyms:

• Benzoic Acid, 2-[(4-Ethoxyphenyl)Amino]-4-Nitro-

2-((4-Ethoxyphenyl)amino)-4-nitrobenzoic acid

CAS: 74859-51-1

Formula: C₁₅H₁₄N₂O₅

Molecular weight: 302.2821

Ref: IN-DA005SHI