
CAS 7486-94-4
:4-Vinyl-2-azetidinone
Description:
4-Vinyl-2-azetidinone, with the CAS number 7486-94-4, is a cyclic amide characterized by its four-membered ring structure containing both a vinyl group and a carbonyl functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity, particularly due to the presence of the vinyl group, which can participate in various polymerization reactions, making it useful in the synthesis of polymers and other organic compounds. The azetidinone ring contributes to its unique chemical properties, including potential applications in medicinal chemistry and materials science. Additionally, 4-Vinyl-2-azetidinone may exhibit moderate to low solubility in water, while being more soluble in organic solvents. Safety considerations should be taken into account, as with many chemical substances, including proper handling and storage to avoid exposure. Overall, its structural features and reactivity make it a compound of interest in various chemical research and industrial applications.
Formula:C5H7NO
InChI:InChI=1S/C5H7NO/c1-2-4-3-5(7)6-4/h2,4H,1,3H2,(H,6,7)
InChI key:InChIKey=ZEWHMWFASYXCAO-UHFFFAOYSA-N
SMILES:C(=C)C1CC(=O)N1
Synonyms:- 4-Ethenyl-2-azetidinone
- NSC 139020
- 2-Azetidinone, 4-vinyl-
- 2-Azetidinone, 4-ethenyl-
- 4-Vinyl-2-azetidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.