CymitQuimica logo

CAS 74863-13-1

:

L-Tyrosine, L-arginyl-, acetate (1:1)

Description:
L-Tyrosine, L-arginyl-, acetate (1:1) is a dipeptide derivative formed from the amino acids L-tyrosine and L-arginine, with an acetate group contributing to its structure. This compound is characterized by its role in protein synthesis and its involvement in various metabolic pathways. L-Tyrosine is a non-essential amino acid that serves as a precursor for neurotransmitters such as dopamine, norepinephrine, and epinephrine, while L-arginine is known for its role in nitric oxide production and its importance in cardiovascular health. The acetate moiety can enhance solubility and stability in biological systems. This compound may exhibit properties such as antioxidant activity and potential neuroprotective effects, making it of interest in nutritional and pharmaceutical applications. Its CAS number, 74863-13-1, allows for easy identification in chemical databases. Overall, L-Tyrosine, L-arginyl-, acetate (1:1) represents a unique combination of amino acids that may have various biological implications and therapeutic potentials.
Formula:C15H23N5O4·C2H4O2
InChI:InChI=1S/C15H23N5O4.C2H4O2/c16-11(2-1-7-19-15(17)18)13(22)20-12(14(23)24)8-9-3-5-10(21)6-4-9;1-2(3)4/h3-6,11-12,21H,1-2,7-8,16H2,(H,20,22)(H,23,24)(H4,17,18,19);1H3,(H,3,4)/t11-,12-;/m0./s1
InChI key:InChIKey=UMLMPXRIYSTILN-FXMYHANSSA-N
SMILES:C([C@H](NC([C@H](CCCNC(=N)N)N)=O)C(O)=O)C1=CC=C(O)C=C1.C(C)(O)=O
Synonyms:
  • L-Tyrosine, L-arginyl-, monoacetate (salt)
  • L-Tyrosine, N-L-arginyl-, monoacetate (salt)
  • L-Tyrosine, L-arginyl-, acetate (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.