CAS 74874-06-9

rel-(2R,4R)-4-Methyl-2-piperidinecarboxylic acid

Description:

Rel-(2R,4R)-4-Methyl-2-piperidinecarboxylic acid, with the CAS number 74874-06-9, is a chiral amino acid derivative characterized by its piperidine ring structure. This compound features a carboxylic acid functional group, which contributes to its acidic properties, and a methyl group at the 4-position of the piperidine ring, influencing its steric and electronic characteristics. The specific stereochemistry, indicated by the (2R,4R) configuration, plays a crucial role in its biological activity and interactions, making it relevant in pharmaceutical applications. The compound is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. Its unique structure allows it to participate in various chemical reactions, including esterification and amidation, and it may serve as a building block in the synthesis of more complex molecules. Overall, rel-(2R,4R)-4-Methyl-2-piperidinecarboxylic acid is significant in medicinal chemistry and organic synthesis.

Formula: C₇H₁₃NO₂

InChI: InChI=1/C7H13NO2/c1-5-2-3-8-6(4-5)7(9)10/h5-6,8H,2-4H2,1H3,(H,9,10)/t5-,6-/s2

InChI key: InChIKey=UQHCHLWYGMSPJC-IOMOGOHMNA-N

SMILES: C(O)(=O)[C@H]1C[C@H](C)CCN1

Synonyms:

• 2-Piperidinecarboxylic acid, 4-methyl-, trans-(±)-
• rel-(2R,4R)-4-Methyl-2-piperidinecarboxylic acid
• 2-Piperidinecarboxylic acid, 4-methyl-, (2R,4R)-rel-