CAS 74875-72-2
:Boc-D-Phe-Pro-Arg-OH
Description:
Boc-D-Phe-Pro-Arg-OH, with the CAS number 74875-72-2, is a synthetic peptide that features a combination of amino acids, specifically a protected form of D-phenylalanine (Boc-D-Phe), proline (Pro), and arginine (Arg). The "Boc" (tert-butyloxycarbonyl) group serves as a protective group for the amino group of D-phenylalanine, facilitating its use in peptide synthesis by preventing unwanted reactions. This compound is typically utilized in the field of biochemistry and medicinal chemistry for research purposes, particularly in the development of peptide-based therapeutics. Its structure allows for specific interactions with biological targets, making it valuable in studies related to protein function and drug design. The presence of the arginine residue suggests potential for positive charge interactions, which can influence the compound's solubility and binding properties. Overall, Boc-D-Phe-Pro-Arg-OH is an important building block in peptide synthesis and has implications in various biochemical applications.
Formula:C25H38N6O6
InChI:InChI=1/C25H38N6O6/c1-2-3-14-37-22(36)24(11-13-31-23(27)28,19(32)17(26)15-16-8-5-4-6-9-16)25(29,21(34)35)20(33)18-10-7-12-30-18/h4-6,8-9,17-18,30H,2-3,7,10-15,26,29H2,1H3,(H,34,35)(H4,27,28,31)
SMILES:CCCCOC(=O)C(CCNC(=N)N)(C(=O)C(Cc1ccccc1)N)C(C(=O)C1CCCN1)(C(=O)O)N
Synonyms:- Butyloxycarbonyl-phenylalanyl-prolyl-arginine
- Bppa
- Boc-phe-pro-arg-H
- 2,5-Diamino-3-(Butoxycarbonyl)-3-{2-[(Diaminomethylidene)Amino]Ethyl}-4-Oxo-6-Phenyl-2-(Pyrrolidin-2-Ylcarbonyl)Hexanoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Boc-D-Phe-Pro-Arg-OH
CAS:Boc-D-Phe-Pro-Arg-OH is a receptor binding molecule that belongs to the family of serine proteases. It has been shown to be reactive with multi-walled carbon nanotubes and fatty acids, making it useful for analytical chemistry, processing and amplification. The Boc-D-Phe-Pro-Arg-OH molecule binds to carbohydrate molecules in a way that mimics the action of an enzyme. This binding activates markers and triggers a reaction that produces hydrogen bonds between the target and the substrate. Boc-D-Phe-Pro-Arg-OH has been shown to have high affinity for serine protease receptors.
Formula:C25H38N6O6Purity:Min. 95%Molecular weight:518.61 g/mol
