CymitQuimica logo

CAS 748758-45-4

:

7-amino-N-cyclohexyl-N,1-dimethyl-thiazolo[3,2-a]benzimidazole-2-carboxamide hydrochloride

Description:
7-amino-N-cyclohexyl-N,1-dimethyl-thiazolo[3,2-a]benzimidazole-2-carboxamide hydrochloride is a chemical compound characterized by its complex structure, which includes a thiazolo-benzimidazole core. This compound features an amino group and a carboxamide functional group, contributing to its potential biological activity. The presence of a cyclohexyl group and dimethyl substituents enhances its lipophilicity, which may influence its pharmacokinetic properties. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, particularly in medicinal chemistry. The compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological effects would depend on the context of its use and the target systems. Its CAS number, 748758-45-4, allows for precise identification and retrieval of information regarding its synthesis, safety data, and regulatory status. Overall, this compound represents a class of heterocyclic compounds that are of interest in drug discovery and development.
Formula:C18H23ClN4OS
InChI:InChI=1/C18H22N4OS.ClH/c1-11-16(17(23)21(2)13-6-4-3-5-7-13)24-18-20-14-9-8-12(19)10-15(14)22(11)18;/h8-10,13H,3-7,19H2,1-2H3;1H
SMILES:Cc1c(C(=O)N(C)C2CCCCC2)sc2nc3ccc(cc3n12)N.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.