CymitQuimica logo

CAS 748776-35-4

:

4-Methoxy-3-[[4-(2-pyridinyl)-1-piperazinyl]sulfonyl]benzoic acid

Description:
4-Methoxy-3-[[4-(2-pyridinyl)-1-piperazinyl]sulfonyl]benzoic acid, with CAS number 748776-35-4, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety, a methoxy group, and a sulfonyl linkage to a piperazine derivative containing a pyridine ring. This compound typically exhibits properties such as moderate solubility in polar solvents and potential bioactivity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. The presence of the piperazine and pyridine groups suggests possible interactions with biological targets, potentially influencing its pharmacological profile. Additionally, the sulfonyl group may enhance the compound's stability and solubility. Its molecular structure allows for various functional modifications, which can be explored to optimize its efficacy and selectivity in biological applications. As with many compounds in medicinal chemistry, understanding its physicochemical properties, such as melting point, boiling point, and spectral characteristics, is crucial for its application in drug development and formulation.
Formula:C17H19N3O5S
InChI:InChI=1S/C17H19N3O5S/c1-25-14-6-5-13(17(21)22)12-15(14)26(23,24)20-10-8-19(9-11-20)16-4-2-3-7-18-16/h2-7,12H,8-11H2,1H3,(H,21,22)
InChI key:InChIKey=AWDBPBCRHQVNHE-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=C(OC)C=CC(C(O)=O)=C1)N2CCN(CC2)C3=CC=CC=N3
Synonyms:
  • Benzoic acid, 4-methoxy-3-[[4-(2-pyridinyl)-1-piperazinyl]sulfonyl]-
  • 4-Methoxy-3-[[4-(2-pyridinyl)-1-piperazinyl]sulfonyl]benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.