CAS 748776-39-8

2-[2-[(4-Bromophenyl)amino]-2-oxoethoxy]benzoic acid hydrazide

Description:

2-[2-[(4-Bromophenyl)amino]-2-oxoethoxy]benzoic acid hydrazide, with the CAS number 748776-39-8, is a chemical compound characterized by its complex structure that includes a benzoic acid moiety, a hydrazide functional group, and a bromophenyl substituent. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of hydrophilic functional groups, while its aromatic components may contribute to hydrophobic interactions. The bromine atom in the 4-position of the phenyl ring can influence the compound's reactivity and biological activity, potentially enhancing its lipophilicity and affecting its interaction with biological targets. The hydrazide functional group may also impart specific reactivity, making it a candidate for various chemical transformations. Additionally, compounds of this nature may exhibit biological activities, including antimicrobial or anticancer properties, making them of interest in medicinal chemistry. Overall, the unique combination of functional groups in this compound suggests potential applications in pharmaceuticals and research.

Formula: C₁₅H₁₄BrN₃O₃

InChI: InChI=1S/C15H14BrN3O3/c16-10-5-7-11(8-6-10)18-14(20)9-22-13-4-2-1-3-12(13)15(21)19-17/h1-8H,9,17H2,(H,18,20)(H,19,21)

InChI key: InChIKey=LZKXQYNXYANDOA-UHFFFAOYSA-N

SMILES: O(CC(NC1=CC=C(Br)C=C1)=O)C2=C(C(NN)=O)C=CC=C2

Synonyms:

• Benzoic acid, 2-[2-[(4-bromophenyl)amino]-2-oxoethoxy]-, hydrazide
• 2-[2-[(4-Bromophenyl)amino]-2-oxoethoxy]benzoic acid hydrazide