CAS 748776-49-0

2,4-Dihydro-4-(2-methylpropyl)-5-[3-(4-morpholinylsulfonyl)phenyl]-3H-1,2,4-triazole-3-thione

Description:

2,4-Dihydro-4-(2-methylpropyl)-5-[3-(4-morpholinylsulfonyl)phenyl]-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its complex structure, which includes a triazole ring, a thione functional group, and a morpholine moiety. This compound is typically classified as a thiazole derivative, exhibiting potential biological activity, particularly in the field of pharmaceuticals. Its molecular structure suggests it may interact with various biological targets, making it of interest in medicinal chemistry. The presence of the morpholine group may enhance its solubility and bioavailability, while the sulfonyl group can contribute to its reactivity and interaction with proteins. The compound's properties, such as solubility, stability, and reactivity, can be influenced by the substituents on the triazole ring and the overall molecular geometry. As with many synthetic compounds, its safety profile, including toxicity and environmental impact, would need to be assessed through rigorous testing. Overall, this compound represents a class of molecules that may have significant applications in drug development and therapeutic interventions.

Formula: C₁₆H₂₂N₄O₃S₂

InChI: InChI=1S/C16H22N4O3S2/c1-12(2)11-20-15(17-18-16(20)24)13-4-3-5-14(10-13)25(21,22)19-6-8-23-9-7-19/h3-5,10,12H,6-9,11H2,1-2H3,(H,18,24)

InChI key: InChIKey=MZTUDDKHXSNMNQ-UHFFFAOYSA-N

SMILES: C(C(C)C)N1C(=NNC1=S)C2=CC(S(=O)(=O)N3CCOCC3)=CC=C2

Synonyms:

• 2,4-Dihydro-4-(2-methylpropyl)-5-[3-(4-morpholinylsulfonyl)phenyl]-3H-1,2,4-triazole-3-thione
• 3H-1,2,4-Triazole-3-thione, 2,4-dihydro-4-(2-methylpropyl)-5-[3-(4-morpholinylsulfonyl)phenyl]-
• Morpholine, 4-[[3-[4,5-dihydro-4-(2-methylpropyl)-5-thioxo-1H-1,2,4-triazol-3-yl]phenyl]sulfonyl]-