CAS 748776-65-0

4-Chloro-3-[[2-propen-1-yl[3-(trifluoromethyl)phenyl]amino]sulfonyl]benzoic acid

Description:

4-Chloro-3-[[2-propen-1-yl[3-(trifluoromethyl)phenyl]amino]sulfonyl]benzoic acid is a synthetic organic compound characterized by its complex structure, which includes a benzoic acid moiety, a sulfonamide group, and a trifluoromethyl-substituted phenyl ring. The presence of the chloro and trifluoromethyl groups contributes to its unique chemical properties, such as increased lipophilicity and potential biological activity. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity may be influenced by the sulfonamide and amine functionalities, which can participate in various chemical reactions. It may also demonstrate specific solubility characteristics, depending on the solvent used, due to the polar sulfonyl group and the hydrophobic aromatic rings. Given its structural complexity, this compound may have applications in pharmaceuticals or agrochemicals, particularly in the development of targeted therapies or as a chemical intermediate. However, detailed studies would be necessary to fully understand its biological activity and potential applications.

Formula: C₁₇H₁₃ClF₃NO₄S

InChI: InChI=1S/C17H13ClF3NO4S/c1-2-8-22(13-5-3-4-12(10-13)17(19,20)21)27(25,26)15-9-11(16(23)24)6-7-14(15)18/h2-7,9-10H,1,8H2,(H,23,24)

InChI key: InChIKey=WNMRCEACBMGXLR-UHFFFAOYSA-N

SMILES: N(S(=O)(=O)C1=CC(C(O)=O)=CC=C1Cl)(CC=C)C2=CC(C(F)(F)F)=CC=C2

Synonyms:

• 4-Chloro-3-[[2-propen-1-yl[3-(trifluoromethyl)phenyl]amino]sulfonyl]benzoic acid
• Benzoic acid, 4-chloro-3-[[2-propenyl[3-(trifluoromethyl)phenyl]amino]sulfonyl]-
• Benzoic acid, 4-chloro-3-[[2-propen-1-yl[3-(trifluoromethyl)phenyl]amino]sulfonyl]-