CAS 748777-12-0
:methyl (2S,3R)-2-(4-methoxyphenyl)pyrrolidine-3-carboxylate
Description:
Methyl (2S,3R)-2-(4-methoxyphenyl)pyrrolidine-3-carboxylate is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered nitrogen-containing ring. The specific stereochemistry indicated by the (2S,3R) notation suggests that the compound has two chiral centers, contributing to its potential for enantiomeric diversity. The presence of the 4-methoxyphenyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The carboxylate functional group, derived from the carboxylic acid, is esterified with a methyl group, which can affect the compound's solubility and reactivity. This compound may exhibit specific pharmacological properties, potentially acting as a ligand for various biological targets. Its structural features suggest that it could be investigated for applications in drug development, particularly in areas related to central nervous system activity or other therapeutic areas. As with many organic compounds, its stability, reactivity, and interactions with other molecules would be influenced by its functional groups and overall molecular structure.
Formula:C13H17NO3
InChI:InChI=1/C13H17NO3/c1-16-10-5-3-9(4-6-10)12-11(7-8-14-12)13(15)17-2/h3-6,11-12,14H,7-8H2,1-2H3/t11-,12-/m1/s1
SMILES:COc1ccc(cc1)[C@@H]1[C@@H](CCN1)C(=O)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
cis-Methyl 2-(4-methoxyphenyl)pyrrolidine-3-carboxylate
CAS:Formula:C13H17NO3Molecular weight:235.2790
