
CAS 748777-72-2
:2,3-Dihydro-3-[(4-hydroxyphenyl)methylene]-1H-cyclopenta[b]quinoline-9-carboxylic acid
Description:
2,3-Dihydro-3-[(4-hydroxyphenyl)methylene]-1H-cyclopenta[b]quinoline-9-carboxylic acid, with the CAS number 748777-72-2, is a synthetic organic compound characterized by its complex bicyclic structure, which includes a quinoline moiety. This compound features a cyclopentane ring fused to a quinoline, contributing to its unique chemical properties. The presence of a hydroxyl group on the phenyl ring enhances its potential for hydrogen bonding, which may influence its solubility and reactivity. Additionally, the carboxylic acid functional group is indicative of acidic properties, allowing for potential interactions in biological systems or with other chemical entities. The compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies on its pharmacokinetics, toxicity, and efficacy would be necessary to fully understand its potential uses.
Formula:C20H15NO3
InChI:InChI=1S/C20H15NO3/c22-14-8-5-12(6-9-14)11-13-7-10-16-18(20(23)24)15-3-1-2-4-17(15)21-19(13)16/h1-6,8-9,11,22H,7,10H2,(H,23,24)
InChI key:InChIKey=RLRNPHISVAQKAJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(C(=CC3=CC=C(O)C=C3)CC2)=NC=4C1=CC=CC4
Synonyms:- 2,3-Dihydro-3-[(4-hydroxyphenyl)methylene]-1H-cyclopenta[b]quinoline-9-carboxylic acid
- 3-[(4-Hydroxyphenyl)methylidene]-1H,2H,3H-cyclopenta[b]quinoline-9-carboxylic acid
- 1H-Cyclopenta[b]quinoline-9-carboxylic acid, 2,3-dihydro-3-[(4-hydroxyphenyl)methylene]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.