CAS 74878-31-2
:Benzoic acid, 4-amino-3,5-dichloro-, ethyl ester
Description:
Benzoic acid, 4-amino-3,5-dichloro-, ethyl ester, identified by the CAS number 74878-31-2, is an organic compound characterized by its ester functional group derived from benzoic acid. This compound features a benzoic acid backbone with amino and dichloro substituents at specific positions on the aromatic ring, which significantly influence its chemical properties and reactivity. The presence of the ethyl ester group enhances its solubility in organic solvents, making it useful in various applications, including as an intermediate in organic synthesis and in the production of pharmaceuticals. The dichloro substituents contribute to its potential biological activity, while the amino group may participate in hydrogen bonding and other interactions. Overall, this compound exhibits characteristics typical of substituted benzoic acids, including moderate melting and boiling points, and it may display varying degrees of acidity and reactivity depending on the surrounding chemical environment. Safety and handling precautions should be observed due to potential toxicity associated with halogenated compounds.
Formula:C9H9Cl2NO2
InChI:InChI=1S/C9H9Cl2NO2/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3-4H,2,12H2,1H3
InChI key:InChIKey=MIDALAPASRDTOZ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC(Cl)=C(N)C(Cl)=C1
Synonyms:- Benzoic acid, 4-amino-3,5-dichloro-, ethyl ester
- 2,6-Dichloro-4-(ethoxycarbonyl)aniline
- Ethyl 4-amino-3,5-dichlorobenzoate
- NSC 212192
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid,4-amino-3,5-dichloro-, ethyl ester
CAS:Formula:C9H9Cl2NO2Purity:98%Color and Shape:SolidMolecular weight:234.0793Ethyl 4-amino-3,5-dichlorobenzoate
CAS:Ethyl 4-amino-3,5-dichlorobenzoate
Purity:≥95%Molecular weight:234.08g/molEthyl 3,5-dichloro-4-aminobenzoate
CAS:Ethyl 3,5-dichloro-4-aminobenzoate is a benzyl amine that has been shown to be an effective inhibitor of nitrile synthesis. It is used as a precursor in the production of dyes and pharmaceuticals. Ethyl 3,5-dichloro-4-aminobenzoate is stable in acidic and alkaline solutions, but decomposes when heated or exposed to cyanide ion. This compound can also react with ethylene diamine to form 2,4-diaminoanisole.Formula:C9H9Cl2NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:234.08 g/mol



