CAS 748797-12-8

Methyl 2-(3-pyrrolidinylthio)acetate

Description:

Methyl 2-(3-pyrrolidinylthio)acetate, identified by its CAS number 748797-12-8, is an organic compound characterized by the presence of a methyl ester functional group and a pyrrolidine ring. This compound typically exhibits a moderate polarity due to the ester and thioether functionalities, which can influence its solubility in various solvents. The pyrrolidine moiety contributes to its potential biological activity, as compounds containing nitrogen heterocycles often exhibit interesting pharmacological properties. Methyl 2-(3-pyrrolidinylthio)acetate may participate in nucleophilic substitution reactions due to the presence of the thioether group, making it a candidate for further chemical transformations. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, this compound represents a unique structure that may be of interest in various fields of chemical research.

Formula: C₇H₁₃NO₂S

InChI: InChI=1S/C7H13NO2S/c1-10-7(9)5-11-6-2-3-8-4-6/h6,8H,2-5H2,1H3

InChI key: InChIKey=RDORTHXTYOIINF-UHFFFAOYSA-N

SMILES: S(CC(OC)=O)C1CCNC1

Synonyms:

• Methyl 2-(3-pyrrolidinylthio)acetate
• Acetic acid, 2-(3-pyrrolidinylthio)-, methyl ester
• 2-(3-Pyrrolidinylsulfanyl)acetic acid methyl ester
• Acetic acid, (3-pyrrolidinylthio)-, methyl ester