CAS 7488-51-9
:Selenious acid, lead(2+) salt (1:1)
Description:
Selenious acid, lead(2+) salt (1:1), with the CAS number 7488-51-9, is an inorganic compound formed from the combination of selenious acid (H2SeO3) and lead(II) ions (Pb²⁺). This compound typically appears as a white or colorless solid and is characterized by its ionic nature, where lead ions are coordinated with selenite anions. It is relatively stable under standard conditions but can be sensitive to moisture and light. The compound is of interest in various chemical applications, including analytical chemistry and materials science, due to its unique properties. However, it is important to note that lead compounds are generally toxic and pose health risks, necessitating careful handling and disposal. The solubility of this salt in water can vary, and it may exhibit different behaviors depending on the pH of the solution. As with many lead-containing substances, regulatory guidelines govern its use and disposal due to environmental and health concerns.
Formula:H2O3Se·Pb
InChI:InChI=1S/H2O3Se.Pb/c1-4(2)3;/h(H2,1,2,3);
InChI key:InChIKey=SEMSFJVJUWNARQ-UHFFFAOYSA-N
SMILES:[Se](=O)(O)O.[Pb]
Synonyms:- Selenious acid, lead(2+) salt (1:1)
- Lead selenite (Pb(SeO3))
- Selenious acid (H2SeO3), lead(2+) salt (1:1)
- Lead(II) selenite
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
