CAS 7488-99-5
:α-Carotene (natural)
Description:
α-Carotene is a natural carotenoid and a precursor to vitamin A, primarily found in various fruits and vegetables, particularly in carrots, sweet potatoes, and leafy greens. It is a fat-soluble pigment that contributes to the orange and yellow coloration of many plants. The chemical structure of α-carotene consists of a long hydrocarbon chain with multiple conjugated double bonds, which are responsible for its antioxidant properties. This compound plays a significant role in human health, as it can be converted into retinol (vitamin A) in the body, essential for vision, immune function, and skin health. α-Carotene is also known for its potential health benefits, including reducing the risk of chronic diseases due to its antioxidant activity, which helps neutralize free radicals. In terms of stability, α-carotene is sensitive to light, heat, and oxygen, which can lead to degradation. Its CAS number is 7488-99-5, and it is often used in dietary supplements and food products for its nutritional benefits and natural coloring properties.
Formula:C40H56
InChI:InChI=1S/C40H56/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-14,17-23,25-28,37H,15-16,24,29-30H2,1-10H3/b12-11+,19-13+,20-14+,27-25+,28-26+,31-17+,32-18+,33-21+,34-22+/t37-/m0/s1
InChI key:InChIKey=ANVAOWXLWRTKGA-NTXLUARGSA-N
SMILES:C(=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C=1C(C)(C)CCCC1C)\C)\C)/C)/C)\[C@@H]2C(C)(C)CCC=C2C
Synonyms:- (+)-α-Carotene
- (6R)-4,5-didehydro-5,6-dihydro-beta,beta-carotene
- (6′R)-α-Carotene
- (6′R)-β,ε-Carotene
- 4',5'-Didehydro-5',6'-Dihydro-Beta
- all-trans-α-Carotene
- alpha-Carotene
- alpha-Carotene natural
- α-Carotene (natural)
- β,ε-Carotene, (6′R)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
α-Carotene
CAS:α-Carotene is isolated from yellow-orange and dark-green vegetables. α-Carotene is used as an anti-metastatic agent or as an adjuvant for anti-cancer drugs.Formula:C40H56Purity:98%Color and Shape:SolidMolecular weight:536.87α-Carotene
CAS:α-Carotene is a carotenoid antioxidant, which is a naturally occurring pigment found primarily in fruits and vegetables. It is derived from plant sources, prominently present in carrots, pumpkins, and other orange-colored produce. As an isomer of β-carotene, α-carotene shares similar properties yet exhibits distinct biological activities due to its unique structure.Formula:C40H56Purity:Min. 95%Molecular weight:536.87 g/mola-Carotene - 10%
CAS:α-Carotene - 10% is a carotenoid compound, which is a natural pigment found predominantly in the orange and yellow fruits and vegetables such as pumpkins and carrots. This compound is synthesized by plants and microorganisms through the isoprenoid biosynthetic pathway. It works primarily as an antioxidant, neutralizing free radicals and protecting cells from oxidative stress, which can lead to cellular damage.Formula:C40H56Purity:Min. 95%Molecular weight:536.87 g/mol





