CAS 748805-97-2

1,1-Dimethylethyl tetrahydro-6-oxo-1,4-oxazepine-4(5H)-carboxylate

Description:

1,1-Dimethylethyl tetrahydro-6-oxo-1,4-oxazepine-4(5H)-carboxylate, identified by its CAS number 748805-97-2, is a chemical compound characterized by its unique oxazepine structure, which includes a seven-membered ring containing both nitrogen and oxygen atoms. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of the dimethyl group indicates steric hindrance, which can influence its chemical behavior and interactions with other molecules. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The tetrahydro configuration suggests that the compound is saturated, which may affect its stability and reactivity. Additionally, the oxo group indicates the presence of a carbonyl functionality, which can participate in various chemical reactions, such as nucleophilic attacks. Overall, this compound's structural features suggest potential applications in medicinal chemistry and materials science, although specific biological or chemical properties would require further investigation through empirical studies.

Formula: C₁₀H₁₇NO₄

InChI: InChI=1S/C10H17NO4/c1-10(2,3)15-9(13)11-4-5-14-7-8(12)6-11/h4-7H2,1-3H3

InChI key: InChIKey=PFSHWTZFMZJJMP-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC(=O)COCC1

Synonyms:

• tert-Butyl 6-oxo-1,4-oxazepan-4-carboxylate
• 1,1-Dimethylethyl tetrahydro-6-oxo-1,4-oxazepine-4(5H)-carboxylate
• 6-Oxo-[1,4]oxazepane-4-carboxylic acid tert-butyl ester
• tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate
• 1,4-Oxazepine-4(5H)-carboxylic acid, tetrahydro-6-oxo-, 1,1-dimethylethyl ester

tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate

CAS: 748805-97-2

Formula: C₁₀H₁₇NO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 215.2463

Ref: IN-DA00G70R

4-Boc-6-oxo-1,4-oxazepane

CAS: 748805-97-2

4-Boc-6-oxo-1,4-oxazepane

Formula: C₁₀H₁₇NO₄

Purity: 95%

Color and Shape: light yellow to light brown solid- liquid

Molecular weight: 215.25g/mol

Ref: 54-OR451216

N-Boc-6-oxo-1,4-oxazepane

CAS: 748805-97-2

Formula: C₁₀H₁₇NO₄

Purity: 95%

Color and Shape: Liquid

Molecular weight: 215.249

Ref: 10-F050523

tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate

CAS: 748805-97-2

tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate is a versatile compound with various applications in different fields. It is an acidic compound that can be used as a building block for the synthesis of other organic molecules. Researchers have found that tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate can interact with certain drugs such as olaparib and irinotecan, enhancing their therapeutic effects.

Formula: C₁₀H₁₇NO₄

Purity: Min. 95%

Molecular weight: 215.25 g/mol

Ref: 3D-YEB80597