
CAS 748805-98-3
:2-Amino-N,α-dimethylbenzenemethanamine
Description:
2-Amino-N,α-dimethylbenzenemethanamine, also known by its CAS number 748805-98-3, is an organic compound characterized by the presence of an amino group and a dimethyl-substituted aromatic ring. This compound features a benzene ring with two methyl groups attached to the alpha position relative to the amino group, which contributes to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the amino group makes it a basic compound, capable of forming salts with acids. Its structure allows for potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. The compound's reactivity can be influenced by the electron-donating effects of the methyl groups, which can enhance nucleophilicity. Safety data should be consulted for handling, as with many amines, it may pose health risks if inhaled or ingested. Overall, 2-Amino-N,α-dimethylbenzenemethanamine is a versatile compound with significant implications in various chemical applications.
Formula:C9H14N2
InChI:InChI=1S/C9H14N2/c1-7(11-2)8-5-3-4-6-9(8)10/h3-7,11H,10H2,1-2H3
InChI key:InChIKey=QBHUZMVIAUIZOA-UHFFFAOYSA-N
SMILES:C(NC)(C)C1=C(N)C=CC=C1
Synonyms:- 2-Amino-N,α-dimethylbenzenemethanamine
- 2-[1-(Methylamino)ethyl]aniline
- Benzenemethanamine, 2-amino-N,α-dimethyl-
- 2-(1-Methylaminoethyl)phenylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.