CAS 748812-37-5

5-bromo-3-fluoro-pyridin-2-amine

Description:

5-Bromo-3-fluoro-pyridin-2-amine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of bromine and fluorine substituents at the 5 and 3 positions, respectively, significantly influences its chemical properties and reactivity. This compound typically exhibits moderate polarity due to the electronegative halogen atoms, which can affect its solubility in various solvents. It is likely to participate in nucleophilic substitution reactions, particularly at the amine group, making it useful in synthetic organic chemistry. The amine functional group can also engage in hydrogen bonding, impacting its boiling and melting points. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its CAS number, 748812-37-5, allows for easy identification in chemical databases. Overall, 5-bromo-3-fluoro-pyridin-2-amine is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₅H₄BrFN₂

InChI: InChI=1/C5H4BrFN2/c6-3-1-4(7)5(8)9-2-3/h1-2H,(H2,8,9)

SMILES: c1c(cnc(c1F)N)Br

Synonyms:

• 2-Pyridinamine, 5-Bromo-3-Fluoro-
• 5-Bromo-3-fluoropyridin-2-amine
• 2-Amino-5-Bromo-3-Fluoropyridine

2-Amino-5-bromo-3-fluoropyridine

CAS: 748812-37-5

Formula: C₅H₄BrFN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 191.0011

Ref: IN-DA0036I2

2-Amino-5-bromo-3-fluoropyridine

CAS: 748812-37-5

Formula: C₅H₄BrFN₂

Purity: >98.0%(GC)(T)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 191.00

Ref: 3B-A3138

5-Bromo-3-fluoropyridin-2-amine

CAS: 748812-37-5

5-Bromo-3-fluoropyridin-2-amine

Purity: 97%

Molecular weight: 191.00g/mol

Ref: 54-PC400726

5-Bromo-3-fluoropyridin-2-amine

CAS: 748812-37-5

Formula: C₅H₄BrFN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 191.003

Ref: 10-F077452