CAS 748817-99-4
:4′-Fluoro-3-(methylthio)-1,1′-biphenyl
Description:
4′-Fluoro-3-(methylthio)-1,1′-biphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the para position and a methylthio group at the meta position on one of the phenyl rings contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in organic synthesis, materials science, and possibly in pharmaceuticals due to the presence of functional groups that can participate in further chemical reactions. The fluorine atom can enhance the compound's stability and influence its electronic properties, while the methylthio group may affect its reactivity and interactions with other molecules. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C13H11FS
InChI:InChI=1S/C13H11FS/c1-15-13-4-2-3-11(9-13)10-5-7-12(14)8-6-10/h2-9H,1H3
InChI key:InChIKey=DFJIDXPKQCOLEP-UHFFFAOYSA-N
SMILES:S(C)C=1C=C(C=CC1)C2=CC=C(F)C=C2
Synonyms:- 1-Fluoro-4-(3-methylsulfanylphenyl)benzene
- 4′-Fluoro-3-(methylthio)-1,1′-biphenyl
- 1,1′-Biphenyl, 4′-fluoro-3-(methylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.