CAS 74885-64-6

3-(2-aminoethyl)-2-methyl-1H-indole-5-carbonitrile

Description:

3-(2-aminoethyl)-2-methyl-1H-indole-5-carbonitrile, with the CAS number 74885-64-6, is a chemical compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features an aminoethyl side chain and a carbonitrile functional group, which contribute to its potential reactivity and biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding and could act as a nucleophile in various chemical reactions. The carbonitrile group can also serve as a versatile functional group in organic synthesis, allowing for further derivatization. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Overall, 3-(2-aminoethyl)-2-methyl-1H-indole-5-carbonitrile is a compound of interest for research in both synthetic and medicinal chemistry contexts.

Formula: C₁₂H₁₃N₃

InChI: InChI=1/C12H13N3/c1-8-10(4-5-13)11-6-9(7-14)2-3-12(11)15-8/h2-3,6,15H,4-5,13H2,1H3

SMILES: Cc1c(CCN)c2cc(ccc2[nH]1)C#N

Synonyms:

• 1H-indole-5-carbonitrile, 3-(2-aminoethyl)-2-methyl-