CAS 7489-66-9: 2-(dimethylamino)ethyl 1,3,4,5-tetrahydrothiopyrano[4,3-b]indole-8-carboxylate

Description:2-(Dimethylamino)ethyl 1,3,4,5-tetrahydrothiopyrano[4,3-b]indole-8-carboxylate, with the CAS number 7489-66-9, is a chemical compound that features a complex structure incorporating both indole and thiopyrano moieties. This compound is characterized by its unique bicyclic framework, which contributes to its potential biological activity. The presence of the dimethylamino group suggests that it may exhibit basic properties, potentially influencing its solubility and reactivity. Additionally, the carboxylate functional group can participate in various chemical reactions, including esterification and salt formation. The tetrahydrothiopyrano structure may impart specific stereochemical properties, affecting its interaction with biological targets. Overall, this compound's intricate structure and functional groups indicate that it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, although specific biological activities would require further investigation through experimental studies.

Formula:C₁₆H₂₀N₂O₂S

InChI:InChI=1/C16H20N2O2S/c1-18(2)6-7-20-16(19)11-3-4-14-12(9-11)13-10-21-8-5-15(13)17-14/h3-4,9,17H,5-8,10H2,1-2H3