CAS 74896-31-4

N-(5-acetyl-2-methoxyphenyl)acetamide

Description:

N-(5-acetyl-2-methoxyphenyl)acetamide, with the CAS number 74896-31-4, is an organic compound characterized by its acetyl and methoxy functional groups attached to a phenyl ring. This compound typically appears as a solid at room temperature and is soluble in organic solvents due to its hydrophobic nature. The presence of the acetyl group contributes to its reactivity, making it a potential candidate for various chemical reactions, including acylation and condensation. The methoxy group enhances its lipophilicity and can influence its biological activity, potentially making it useful in pharmaceutical applications. The compound's structure suggests it may exhibit specific interactions with biological targets, which could be explored in medicinal chemistry. Additionally, its stability under standard laboratory conditions allows for ease of handling and storage. Overall, N-(5-acetyl-2-methoxyphenyl)acetamide is a compound of interest in both synthetic organic chemistry and potential therapeutic applications.

Formula: C₁₁H₁₃NO₃

InChI: InChI=1/C11H13NO3/c1-7(13)9-4-5-11(15-3)10(6-9)12-8(2)14/h4-6H,1-3H3,(H,12,14)

SMILES: CC(=O)c1ccc(c(c1)N=C(C)O)OC

Synonyms:

• acetamide, N-(5-acetyl-2-methoxyphenyl)-
• N-(5-Acetyl-2-methoxyphenyl)acetamide

N-(5-acetyl-2-methoxyphenyl)acetamide

CAS: 74896-31-4

Formula: C₁₁H₁₃NO₃

Purity: 97%

Molecular weight: 207.2258

Ref: IN-DA003ISB

N-(5-Acetyl-2-Methoxyphenyl)Acetamide

CAS: 74896-31-4

N-(5-Acetyl-2-Methoxyphenyl)Acetamide

Purity: 98%

Molecular weight: 207.23g/mol

Ref: 54-OR1026822