CAS 749-18-8
:η-Pyrromycinone
Description:
η-Pyrromycinone, with the CAS number 749-18-8, is a chemical compound that belongs to the class of pyridones. It is characterized by a bicyclic structure that incorporates a pyridine ring fused to a ketone group, which contributes to its unique reactivity and properties. This compound is known for its potential biological activity, particularly in the field of medicinal chemistry, where it may exhibit antimicrobial or antifungal properties. η-Pyrromycinone is typically a solid at room temperature and may have specific solubility characteristics depending on the solvent used. Its molecular structure allows for various functional group modifications, making it a versatile intermediate in organic synthesis. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many chemical substances, safety precautions should be taken when handling η-Pyrromycinone, as it may pose health risks if ingested or inhaled. Overall, η-Pyrromycinone is an interesting compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C22H16O7
InChI:InChI=1/C22H16O7/c1-3-9-4-5-10-11(15(9)22(28)29-2)8-12-16(19(10)25)21(27)18-14(24)7-6-13(23)17(18)20(12)26/h4-8,23-25H,3H2,1-2H3
InChI key:InChIKey=DIAOGWYBBJCPAD-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC=3C(C2O)=CC=C(CC)C3C(OC)=O)C(=O)C=4C1=C(O)C=CC4O
Synonyms:- 1-Naphthacenecarboxylic acid, 2-ethyl-6,11-dihydro-5,7,10-trihydroxy-6,11-dioxo-, methyl ester
- η-Pyrromycinone
- 2-Ethyl-6,11-dihydro-5,7,10-trihydroxy-6,11-dioxo-1-naphthacenecarboxylic acid methyl ester
- Bisanhydro-ε-pyrromycinone
- Bisanhydropyrromycinone
- Cyclacidin
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cyclacidin
CAS:Cyclacidin exhibits activity against Gram-positive bacteria, such as Bacillus subtilis and Gambosia occidentalis, and demonstrates inhibitory effects on Sarcoma 180, among others.Formula:C22H16O7Color and Shape:SolidMolecular weight:392.358
