CAS 74908-88-6
:α-Hydroxy-4-(2-oxiranylmethoxy)benzeneacetamide
Description:
α-Hydroxy-4-(2-oxiranylmethoxy)benzeneacetamide, with the CAS number 74908-88-6, is a chemical compound that features a unique structure characterized by the presence of an α-hydroxy group, an aromatic benzene ring, and an epoxide (oxirane) moiety. This compound is likely to exhibit properties typical of both amides and phenolic compounds, which may include moderate solubility in polar solvents and potential reactivity due to the epoxide group. The α-hydroxy group can contribute to its ability to participate in hydrogen bonding, influencing its physical and chemical behavior. Additionally, the presence of the methoxy group may enhance its lipophilicity, affecting its biological activity and interaction with other molecules. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in drug development and as intermediates in organic synthesis. However, specific data regarding its stability, reactivity, and biological properties would require further investigation through experimental studies.
Formula:C11H13NO4
InChI:InChI=1S/C11H13NO4/c12-11(14)10(13)7-1-3-8(4-2-7)15-5-9-6-16-9/h1-4,9-10,13H,5-6H2,(H2,12,14)
InChI key:InChIKey=WKZBKYGIPVWYKE-UHFFFAOYSA-N
SMILES:C(C(N)=O)(O)C1=CC=C(OCC2CO2)C=C1
Synonyms:- Benzeneacetamide, α-hydroxy-4-(2-oxiranylmethoxy)-
- α-Hydroxy-4-(2-oxiranylmethoxy)benzeneacetamide
- Benzeneacetamide, α-hydroxy-4-(oxiranylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
a-Hydroxy-4-(2-oxiranylmethoxy)-benzeneacetamide
CAS:Controlled ProductApplications α-Hydroxy-4-(2-oxiranylmethoxy)-benzeneacetamide is an intermediate in the synthesis of hydroxyatenolol (H802480), which is a metabolite of Atenolol (A790075); a cardioselective β-adrenergic blocker, antihypertensive, antianginal, and antiarrhythmic (class II).
References Escher, B., et al.: Environ. Sci. Technol., 40, 7402 (2006); Caplar, V., et al.: Anal. Profiles Drug Subs., 13, 1 (1984)Formula:C11H13NO4Color and Shape:Off-WhiteMolecular weight:223.23
